A8353012
Vanadium(III) acetylacetonate , 97% , 13476-99-8
Synonym(s):
2,4-Pentanedione vanadium(III) derivative
CAS NO.:13476-99-8
Empirical Formula: C15H21O6V
Molecular Weight: 348.27
MDL number: MFCD00000033
EINECS: 236-759-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB118.40 | In Stock |
|
| 25G | RMB430.40 | In Stock |
|
| 100G | RMB779.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-184 °C(lit.) |
| Boiling point: | 170°C 0,05mm |
| Density | 1.050 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in methanol, acetone, benzene
chloroform |
| form | crystal |
| color | brown |
| Water Solubility | Soluble in water 2g/L, toluene, ethanol, acetone. |
| Sensitive | Air Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 4148970 |
| Exposure limits | NIOSH: Ceiling 0.05 mg/m3 |
| InChI | 1S/3C5H8O2.V/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | JTPOGAMSYINTGF-LNTINUHCSA-K |
| SMILES | CC(=O)\C=C(\C)O[V](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| LogP | 0.05 |
| CAS DataBase Reference | 13476-99-8 |
| EPA Substance Registry System | Vanadium, tris(2,4-pentanedionato-.kappa.O,.kappa.O')-, (OC-6-11)- (13476-99-8) |
Description and Uses
Vanadium(III) acetylacetonate can be used as a soluble catalyst, which acts as a redox mediator that allows effective oxidation of lithium peroxide for lithium-ion batteries. It can also be used as source material for the preparation of vanadium dioxide films by chemical vapor deposition (CVD) technique.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36-45 |
| RIDADR | UN 3285 6.1/PG 3 |
| WGK Germany | 3 |
| F | 23-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





