![2,2'-Bis[(4S)-4-Benzyl-2-oxazoline]](https://img.chemicalbook.com/CAS/GIF/133463-88-4.gif)
A8353532
2,2'-Bis[(4S)-4-Benzyl-2-oxazoline] , 98% , 133463-88-4
Synonym(s):
(S,S)-2,2′-Bis(4-benzyl-2-oxazoline);(S,S)-4,4′-Dibenzyl-2,2′-bi(2-oxazoline)
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB143.20 | In Stock |
|
| 100MG | RMB239.20 | In Stock |
|
| 250mg | RMB519.20 | In Stock |
|
| 1g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-132 °C(lit.) |
| Boiling point: | 449.3±28.0 °C(Predicted) |
| Density | 1.21±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 3.89±0.70(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D 40.6°, c = 1 in ethanol |
| BRN | 4756827 |
| InChI | 1S/C20H20N2O2/c1-3-7-15(8-4-1)11-17-13-23-19(21-17)20-22-18(14-24-20)12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18-/m0/s1 |
| InChIKey | OIEQQWQZUYZCRJ-ROUUACIJSA-N |
| SMILES | C1OC(=N[C@H]1Cc2ccccc2)C3=N[C@H](CO3)Cc4ccccc4 |
Description and Uses
2,2′-Bis[(4S)-4-benzyl-2-oxazoline] can be used as:
- A catalyst for the enantioselective hydrosilylation of ketones.
- A Schiff base ligand in the preparation of rhodium(I) and palladium(II) coordination complexes.
- A ligand in the formation of copper(I) halide complexes; applicable in the synthesis of coordination polymers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
