A8355312
Vinclozolin , Analysis standard product, 99% , 50471-44-8
CAS NO.:50471-44-8
Empirical Formula: C12H9Cl2NO3
Molecular Weight: 286.11
MDL number: MFCD00055511
EINECS: 256-599-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB287.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108℃ |
| Boiling point: | 131℃ (0.05mmHg) |
| Density | 1.51 g/cm3 |
| vapor pressure | 1.3 x 10-4 Pa (20 °C) |
| refractive index | 1.6100 (estimate) |
| Flash point: | 2 °C |
| storage temp. | APPROX 4°C |
| solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,Ethanol: 30 mg/ml,Ethanol:PBS(pH 7.2) (1:1): 0.5 mg/ml |
| Water Solubility | 3.4 mg l-1 (20 °C) |
| pka | -3.43±0.40(Predicted) |
| Merck | 13,10046 |
| BRN | 8331312 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C12H9Cl2NO3/c1-3-12(2)10(16)15(11(17)18-12)9-5-7(13)4-8(14)6-9/h3-6H,1H2,2H3 |
| InChIKey | FSCWZHGZWWDELK-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)N(C1=O)c2cc(Cl)cc(Cl)c2)C=C |
| EPA Substance Registry System | Vinclozolin (50471-44-8) |
Description and Uses
Agricultural fungicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H317-H351-H360FD-H411 |
| Precautionary statements | P201-P261-P273-P280-P308+P313-P391 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,N,Xn,F |
| Risk Statements | 60-61-40-43-51/53-36-20/21/22-11 |
| Safety Statements | 53-45-61-36-26-16-36/37 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | RP8530000 |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 2 Carc. 2 Repr. 1B Skin Sens. 1 |
| Hazardous Substances Data | 50471-44-8(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 10 g/kg (Hess, Locher) |






