A8356812
trans-Vaccenic acid , 99% , 693-72-1
Synonym(s):
trans-11-Octadecenoic acid;11-trans-Octadecenoic acid
CAS NO.:693-72-1
Empirical Formula: C18H34O2
Molecular Weight: 282.46
MDL number: MFCD00002734
EINECS: 211-758-9
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB719.20 | In Stock |
|
| 500MG | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44℃ |
| Boiling point: | 397.91°C (estimate) |
| Density | 0.8563 |
| refractive index | 1.4472 (589.3 nm 50℃) |
| Flash point: | 113 °C |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 4.78±0.10(Predicted) |
| color | Clear Colourless |
| biological source | synthetic (organic) |
| Merck | 13,9965 |
| InChI | 1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-8H,2-6,9-17H2,1H3,(H,19,20)/b8-7+ |
| InChIKey | UWHZIFQPPBDJPM-BQYQJAHWSA-N |
| SMILES | CCCCCC\C=C/CCCCCCCCCC(O)=O |
| CAS DataBase Reference | 693-72-1(CAS DataBase Reference) |
Description and Uses
Vaccenic Acid is a fatty acid found in Artemia salina that shows antimicrobial activity against a variety of microorganisms except Escherichia coli, Micrococcus luteus and Salmonella enteritidis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







