T8897030
Ethyl 2,3-Butadienoate , >95.0%(GC) , 14369-81-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB648.00 | In Stock |
|
| 5g | RMB2200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80 °C60 mm Hg(lit.) |
| Density | 0.966 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 116 °F |
| storage temp. | <0°C |
| form | clear liquid |
| color | Colorless to Light yellow |
| λmax | 209nm(MeOH)(lit.) |
| InChI | 1S/C6H8O2/c1-3-5-6(7)8-4-2/h5H,1,4H2,2H3 |
| InChIKey | GLSUOACRAMLJIW-UHFFFAOYSA-N |
| SMILES | [H]C([H])=C=C([H])C(=O)OCC |
Description and Uses
Ethyl 2,3-butadienoate may be used in the synthesis of dihydropyrans by reacting with acyclic enones. It may also be used to synthesize spiranic heterocycles by reacting with heterocyclic bis-arylidene ketones via phosphine-catalyzed [3+2] annulations.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241-P242-P243 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29161900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |







