A8358312
Vitexicarpin , Analysis of standard products, ≥98%(HPLC) , 479-91-4
Synonym(s):
Casticin;Vitexicarpin;Casticine;Quercetagetin 3,4′,6,7-tetramethyl ether;Quercetagetin 3,6,7,4′-tetramethyl ether
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB658.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-187 °C |
| Boiling point: | 617.7±55.0 °C(Predicted) |
| Density | 1.44±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | ethanol: soluble1mg/mL, clear, colorless to light yellow |
| form | Solid |
| pka | 6.13±0.40(Predicted) |
| color | Yellow |
| BRN | 1300392 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C19H18O8/c1-23-11-6-5-9(7-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3 |
| InChIKey | PJQLSMYMOKWUJG-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OC)C(O)=C2)OC2=CC(OC)=C(OC)C(O)=C2C(=O)C=1OC |
| CAS DataBase Reference | 479-91-4(CAS DataBase Reference) |
Description and Uses
Casticin is a biological compound known to induce human glioma cell death through an apoptotic mechanism and disruption of the mitotic cycle.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |





