PRODUCT Properties
| refractive index | 1.47 |
| storage temp. | room temp |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| Colour Index | 42595 |
| form | Liquid |
| color | Clear blue |
| λmax | 619 nm |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | InChI=1S/C33H39N3.ClH/c1-6-34-32-24-23-31(29-13-11-12-14-30(29)32)33(25-15-19-27(20-16-25)35(7-2)8-3)26-17-21-28(22-18-26)36(9-4)10-5;/h11-24H,6-10H2,1-5H3;1H |
| InChIKey | ROVRRJSRRSGUOL-UHFFFAOYSA-N |
| SMILES | C(=C1C=C/C(=[N+](/CC)\CC)/C=C1)(C1C=CC(N(CC)CC)=CC=1)C1=CC=C(NCC)C2=CC=CC=C12.[Cl-] |
| CAS DataBase Reference | 2390-60-5(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanaminium, N-[4-[[4-(diethylamino)phenyl][4-(ethylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, chloride (2390-60-5) |
Description and Uses
Basic Blue 7100 (CAS# 2390-60-5) is a dye with antimicrobial properties. Basic Blue 7100 is a toxic substance with a toxicologial screening value of 0.0025 ug/kg body weight per day. Dyes and metabolites, Environmental Testing
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 24/25 |
| RIDADR | 3143 |
| WGK Germany | 3 |
| HS Code | 3204.13.8000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |





