A8369212
Vinyl 4-<i>tert</i>-Butylbenzoate , >98.0%(GC) , 15484-80-7
Synonym(s):
Vinyl 4-(1,1-dimethylethyl)benzoate
CAS NO.:15484-80-7
Empirical Formula: C13H16O2
Molecular Weight: 204.26
MDL number: MFCD00080692
EINECS: 239-510-5
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB55.20 | In Stock |
|
| 25ML | RMB159.20 | In Stock |
|
| 100ML | RMB311.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100 °C/0.5 mmHg (lit.) |
| Density | 0.999 g/mL at 25 °C (lit.) |
| vapor pressure | 0.133Pa at 20℃ |
| refractive index | n |
| Flash point: | >230 °F |
| solubility | soluble in Methanol |
| form | Liquid |
| Specific Gravity | 1.000 |
| color | Colorless to Almost colorless |
| InChI | 1S/C13H16O2/c1-5-15-12(14)10-6-8-11(9-7-10)13(2,3)4/h5-9H,1H2,2-4H3 |
| InChIKey | ZLHVSEPPILCZHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(cc1)C(=O)OC=C |
| LogP | 3.94 at 25℃ and pH7 |
| Surface tension | 31.9mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 15484-80-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H410-H317-H373-H360F |
| Precautionary statements | P273-P391-P501-P260-P314-P501-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P264-P270-P301+P312-P330-P501 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| HS Code | 2916.39.7900 |
| Storage Class | 10 - Combustible liquids |
| REACH Registrations | Inactive |








