A8399312
2,5-Dibromo-3-nitropyridine , 98% , 15862-37-0
CAS NO.:15862-37-0
Empirical Formula: C5H2Br2N2O2
Molecular Weight: 281.89
MDL number: MFCD09266223
EINECS: 808-084-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB149.60 | In Stock |
|
| 100G | RMB563.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92.0 to 96.0 °C |
| Boiling point: | 272.7±35.0 °C(Predicted) |
| Density | 2+-.0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | soluble in Methanol |
| pka | -5.60±0.20(Predicted) |
| form | Solid |
| color | Yellow |
| InChI | InChI=1S/C5H2Br2N2O2/c6-3-1-4(9(10)11)5(7)8-2-3/h1-2H |
| InChIKey | OQKWPJCAKRVADO-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(Br)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 15862-37-0(CAS DataBase Reference) |
Description and Uses
2,5-Dibromo-3-nitropyridine is used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |






