A8413312
3,6-Dibromo-2-methylpyridine , 97% , 39919-65-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 250mg | RMB23.20 | In Stock |
|
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100g | RMB317.60 | In Stock |
|
| 500g | RMB1469.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 0°C |
| Boiling point: | 0°C |
| Density | 1.911±0.06 g/cm3(Predicted) |
| Flash point: | 0°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -0.84±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H5Br2N/c1-4-5(7)2-3-6(8)9-4/h2-3H,1H3 |
| InChIKey | UCHKRHGVKYVGTC-UHFFFAOYSA-N |
| SMILES | C1(C)=NC(Br)=CC=C1Br |
| CAS DataBase Reference | 39919-65-8(CAS DataBase Reference) |
Description and Uses
2,5-Dibromo-6-methylpyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310+P330-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |






