A8401112
3,5-Difluorobenzenesulfonyl chloride , 97% , 210532-25-5
CAS NO.:210532-25-5
Empirical Formula: C6H3ClF2O2S
Molecular Weight: 212.6
MDL number: MFCD02091378
EINECS: 625-780-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB162.72 | In Stock |
|
| 25G | RMB408.96 | In Stock |
|
| 100G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-59°C |
| Boiling point: | 231.9±20.0 °C(Predicted) |
| Density | 1.580±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| color | Orange to tan |
| Sensitive | Moisture Sensitive |
| BRN | 8053561 |
| InChI | 1S/C6H3ClF2O2S/c7-12(10,11)6-2-4(8)1-5(9)3-6/h1-3H |
| InChIKey | IIQKIICAOXAXEJ-UHFFFAOYSA-N |
| SMILES | Fc1cc(F)cc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 210532-25-5(CAS DataBase Reference) |
Description and Uses
3,5-Difluorobenzenesulfonyl chloride may be used to synthesize the following:
- N,N-diethyl-3,5-difluorobenzene sulfonamide
- N-phenyl-3,5-difluorobenzene sulfonamide
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






