A8402512
2-Bromo-5-nitrobenzonitrile , 97% , 134604-07-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB152.00 | In Stock |
|
| 25g | RMB550.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-120 °C |
| Boiling point: | 321.1±32.0 °C(Predicted) |
| Density | 1.81±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder |
| Appearance | White to off-white Solid |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C7H3BrN2O2/c8-7-2-1-6(10(11)12)3-5(7)4-9/h1-3H |
| InChIKey | RKODNVITKISFKU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC([N+]([O-])=O)=CC=C1Br |
Description and Uses
2-Bromo-5-nitrobenzonitrile is a benzonitrile derivative. The bromine atom on its benzene ring can be used in substitution reactions; the nitro group can be used in reductive amination or sulfonation reactions. This product is widely used in organic synthesis to prepare other heterocyclic compounds.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37-60 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |







