A8405812
3-Bromo-5-iodopyridine , 95% , 233770-01-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB29.60 | In Stock |
|
| 1G | RMB66.40 | In Stock |
|
| 5G | RMB212.00 | In Stock |
|
| 25G | RMB853.60 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-131 °C |
| Boiling point: | 266.5±25.0 °C(Predicted) |
| Density | 2.347±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 0.85±0.20(Predicted) |
| form | Solid |
| color | Off-white |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C5H3BrIN/c6-4-1-5(7)3-8-2-4/h1-3H |
| InChIKey | AOOZLVWDZUPEHT-UHFFFAOYSA-N |
| SMILES | C1=NC=C(I)C=C1Br |
| CAS DataBase Reference | 233770-01-9(CAS DataBase Reference) |
Description and Uses
Reactant in the synthesis chiral 4, 4?-Bipyridines. 3-bromo-5-(trifluoromethyl)pyridine is prepared from 3-Bromo-5-iodopyridine.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







