A8407812
2,4-Dihydroxy-6-methyl-5-nitropyrimidine , 99% , 16632-21-6
CAS NO.:16632-21-6
Empirical Formula: C5H5N3O4
Molecular Weight: 171.11
MDL number: MFCD00051201
EINECS: 240-688-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.68 | In Stock |
|
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB172.08 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290-291°C dec. |
| Density | 1.58±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF, DMSO, Hot Methanol, Hot Water |
| form | Solid |
| pka | 6.24±0.10(Predicted) |
| color | Light Yellow Crystalline |
| Water Solubility | Soluble in DMF, DMSO, hot methanol and hot water. |
| InChI | InChI=1S/C5H5N3O4/c1-2-3(8(11)12)4(9)7-5(10)6-2/h1H3,(H2,6,7,9,10) |
| InChIKey | LIVYMRJSNFHYEN-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)=C([N+]([O-])=O)C(=O)N1 |
| CAS DataBase Reference | 16632-21-6(CAS DataBase Reference) |
Description and Uses
A synthetic intermediate
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H302-H318-H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41-40 |
| Safety Statements | 26-39-36-22 |
| WGK Germany | 3 |
| HS Code | 29335990 |





