A8408812
4-(Dimethylamino)butyric acid hydrochloride , 98% , 69954-66-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB37.60 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100g | RMB935.20 | In Stock |
|
| 500g | RMB4479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| Appearance | Off-white to pink Solid |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C6H13NO2.ClH/c1-7(2)5-3-4-6(8)9;/h3-5H2,1-2H3,(H,8,9);1H |
| InChIKey | RDTALXUBMCLWBB-UHFFFAOYSA-N |
| SMILES | C(=O)(O)CCCN(C)C.Cl |
| CAS DataBase Reference | 69954-66-1(CAS DataBase Reference) |
Description and Uses
4-Dimethylaminobutyric acid hydrochloride is used as pharmaceutical intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
