A8409012
4-[(tert-Butoxycarbonylamino)methyl]benzoic Acid , 98% , 33233-67-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 250mg | RMB23.20 | In Stock |
|
| 5G | RMB118.40 | In Stock |
|
| 25G | RMB440.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-168 °C |
| Boiling point: | 427.8±38.0 °C(Predicted) |
| Density | 1.178±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline |
| pka | 4.25±0.10(Predicted) |
| color | Off-white |
| BRN | 2854286 |
| Major Application | peptide synthesis |
| InChI | 1S/C13H17NO4/c1-13(2,3)18-12(17)14-8-9-4-6-10(7-5-9)11(15)16/h4-7H,8H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | LNKHBRDWRIIROP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(cc1)C(O)=O |
| CAS DataBase Reference | 33233-67-9(CAS DataBase Reference) |
Description and Uses
4-(Boc-aminomethyl)benzoic Acid is the Boc protected form of 4-(Aminomethyl)benzoic Acid (A615230) and is used as a reagent in the synthesis of indoleamide derivatives as EP2 antagonists with high selectivity. 4-(Boc-aminomethyl)benzoic Acid is also used as a reagent in the synthesis of aminopyridine-derived amides as nicotinamide phosphoribosyltransferase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |

![4-[(tert-Butoxycarbonylamino)methyl]benzoic Acid](https://img.chemicalbook.com/CAS/GIF/33233-67-9.gif)

