A8410112
(1-Ethoxyethylidene)malononitrile , 98% , 5417-82-3
CAS NO.:5417-82-3
Empirical Formula: C7H8N2O
Molecular Weight: 136.15
MDL number: MFCD00001852
EINECS: 226-521-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB37.60 | In Stock |
|
| 5g | RMB74.40 | In Stock |
|
| 10G | RMB100.00 | In Stock |
|
| 25G | RMB232.00 | In Stock |
|
| 100G | RMB636.80 | In Stock |
|
| 500g | RMB2568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C(lit.) |
| Boiling point: | 250.42°C (rough estimate) |
| Density | 1.1778 (rough estimate) |
| refractive index | 1.5769 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Dichloromethane |
| form | Crystalline Powder and Chunks |
| color | White to beige |
| InChI | InChI=1S/C7H8N2O/c1-3-10-6(2)7(4-8)5-9/h3H2,1-2H3 |
| InChIKey | BOSVWXDDFBSSIZ-UHFFFAOYSA-N |
| SMILES | C(#N)/C(=C(/OCC)\C)/C#N |
| CAS DataBase Reference | 5417-82-3(CAS DataBase Reference) |
| EPA Substance Registry System | Propanedinitrile, (1-ethoxyethylidene)- (5417-82-3) |
Description and Uses
(1-Ethoxyethylidene)malononitrile was used in the synthesis of benzyl 5-amino-4-cyano-3-methyl-1H pyrazole-1-carboxylate and 2-amino-6-mercaptopyridine-3,5-dicarbonitrile derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | TY1510000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29269090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






![2-[3-CYANO-4-(4-FLUOROPHENYL)-5,5-DIMETHYL-5H-FURAN-2-YLIDENE]MALONONITRILE](https://img.chemicalbook.com/CAS/GIF/425604-51-9.gif)