A8418912
2,3-Dichloro-5-nitropyridine , 97% , 22353-40-8
CAS NO.:22353-40-8
Empirical Formula: C5H2Cl2N2O2
Molecular Weight: 192.99
MDL number: MFCD03840432
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25g | RMB232.00 | In Stock |
|
| 100g | RMB776.00 | In Stock |
|
| 500g | RMB3736.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-56℃ |
| Boiling point: | 256°C(lit.) |
| Density | 1.629±0.06 g/cm3(Predicted) |
| Flash point: | >110°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -4.99±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C5H2Cl2N2O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H |
| InChIKey | XLPDVAVQKGDHNO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1Cl |
| CAS DataBase Reference | 22353-40-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-43-41-37/38-25 |
| Safety Statements | 26-36/37/39-45-39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







