A8419112
3,3-Difluoropiperidine hydrochloride , 97% , 496807-97-7
CAS NO.:496807-97-7
Empirical Formula: C5H10ClF2N
Molecular Weight: 157.59
MDL number: MFCD03452800
EINECS: 624-735-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB92.80 | In Stock |
|
| 1G | RMB237.60 | In Stock |
|
| 5G | RMB727.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-247 °C |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Orange to Green |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C5H9F2N.ClH/c6-5(7)2-1-3-8-4-5;/h8H,1-4H2;1H |
| InChIKey | LEHHIPIDKQVNEV-UHFFFAOYSA-N |
| SMILES | FC1(CNCCC1)F.Cl |
| CAS DataBase Reference | 496807-97-7(CAS DataBase Reference) |
Description and Uses
3,3-Difluoropiperidine, HCl
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







