A5294612
Loperamide HCl , ≥98% , 34552-83-5
Synonym(s):
µ-Opioid Receptor Agonist, Loperamide Hydrochloride, Imodium;4-(p-Chlorophenyl)-4-hydroxy-N,N-dimethyl-α,α-diphenyl-1-piperidinebutyramide hydrochloride;Loperamide Hydrochloride - CAS 34552-83-5 - Calbiochem;LPM
CAS NO.:34552-83-5
Empirical Formula: C29H34Cl2N2O2
Molecular Weight: 513.5
MDL number: MFCD00058581
EINECS: 252-082-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB79.20 | In Stock |
|
| 5G | RMB319.20 | In Stock |
|
| 25G | RMB1279.20 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-225°C |
| Density | 1.1905 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | 2-8°C |
| solubility | Slightly soluble in water, freely soluble in ethanol (96 per cent) and in methanol. |
| pka | 8.66(at 25℃) |
| form | Solid |
| color | White to Almost white |
| Merck | 14,5571 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C29H33ClN2O2.ClH/c1-31(2)27(33)29(24-9-5-3-6-10-24,25-11-7-4-8-12-25)19-22-32-20-17-28(34,18-21-32)23-13-15-26(30)16-14-23;/h3-16,34H,17-22H2,1-2H3;1H |
| InChIKey | PGYPOBZJRVSMDS-UHFFFAOYSA-N |
| SMILES | C(C(=O)N(C)C)(CCN1CCC(O)(C2C=CC(Cl)=CC=2)CC1)(C1=CC=CC=C1)C1=CC=CC=C1.Cl |
| CAS DataBase Reference | 34552-83-5(CAS DataBase Reference) |
Description and Uses
Ca channel blocker
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P330+P331+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | TM4960000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 in mice (mg/kg): 75 s.c.; 28 i.p.; 105 orally; in rats (mg/kg): 185 orally (Niemegeers) |






