A8419212
3-(1-Cyanoethyl)benzoic acid , >98.0%(GC) , 5537-71-3
CAS NO.:5537-71-3
Empirical Formula: C10H9NO2
Molecular Weight: 175.18
MDL number: MFCD00002520
EINECS: 226-897-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB88.80 | In Stock |
|
| 100G | RMB278.40 | In Stock |
|
| 500g | RMB1013.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-148 °C (lit.) |
| Boiling point: | 355.8±25.0 °C(Predicted) |
| Density | 1.204±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.96±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C10H9NO2/c1-7(6-11)8-3-2-4-9(5-8)10(12)13/h2-5,7H,1H3,(H,12,13) |
| InChIKey | IRYIYPWRXROPSX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(C(C#N)C)=C1 |
| CAS DataBase Reference | 5537-71-3(CAS DataBase Reference) |
Description and Uses
3-(1-Cyanoethyl)benzoic Acid is a intermediate for the synthetic preparation of various pharmaceutical compounds. 3-(1-Cyanoethyl)benzoic Acid was used in studies examining the enantioselectivity of n itrile hydratases.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-41-43 |
| Safety Statements | 26-36/37/39-36/37/38 |
| WGK Germany | 3 |
| HS Code | 2926907090 |





