A8419712
9-Phenanthrenecarboxaldehyde , 97% , 4707-71-5
CAS NO.:4707-71-5
Empirical Formula: C15H10O
Molecular Weight: 206.24
MDL number: MFCD00001175
EINECS: 225-194-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB54.40 | In Stock |
|
| 1G | RMB176.00 | In Stock |
|
| 5G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-103 °C (lit.) |
| Boiling point: | 160-170 °C(Press: 1 Torr) |
| Density | 1.217±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble in acetone, dichloromethane, methanol. |
| form | Powder |
| color | Pale yellow |
| Sensitive | Air Sensitive |
| BRN | 511309 |
| InChI | 1S/C15H10O/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-10H |
| InChIKey | QECIGCMPORCORE-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cc2ccccc2c3ccccc13 |
| CAS DataBase Reference | 4707-71-5(CAS DataBase Reference) |
Description and Uses
Phenanthrene-9-carboxaldehyde is a phenanthrene derivative used to make fluorescent probes.






