PRODUCT Properties
| Melting point: | 260°C |
| storage temp. | Inert atmosphere,2-8°C |
| form | Solid |
| color | White to light yellow |
| Merck | 14,777 |
| BRN | 3913792 |
| InChI | InChI=1S/C7H11NO2.ClH/c1-8-4-2-3-6(5-8)7(9)10;/h3H,2,4-5H2,1H3,(H,9,10);1H |
| InChIKey | PIVDNPNYIBGXPL-UHFFFAOYSA-N |
| SMILES | C1(C(=O)O)=CCCN(C)C1.Cl |
Description and Uses
Arecaidine Hydrochloride is a reactant used for the synthesis of dienone Elaeocarpus alkaloids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | QT2087000 |
