A8421512
4-Bromo-2-methoxybenzoic acid , 97% , 72135-36-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB83.20 | In Stock |
|
| 25g | RMB376.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-159°C |
| Boiling point: | 318.1±27.0 °C(Predicted) |
| Density | 1.625±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.86±0.10(Predicted) |
| form | powder |
| color | Off white |
| InChI | InChI=1S/C8H7BrO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | CEZLPETXJOGAKX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C=C1OC |
Description and Uses
4-Bromo-2-methoxybenzoic acid is a nucleophilic reagent that can be used to synthesize other compounds.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2918999090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
