A8421512
4-Bromo-2-methoxybenzoic acid , 97% , 72135-36-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB83.20 | In Stock |
|
| 25g | RMB376.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-159°C |
| Boiling point: | 318.1±27.0 °C(Predicted) |
| Density | 1.625±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.86±0.10(Predicted) |
| form | powder |
| color | Off white |
| InChI | InChI=1S/C8H7BrO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | CEZLPETXJOGAKX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C=C1OC |
Description and Uses
4-Bromo-2-methoxybenzoic acid is a nucleophilic reagent that can be used to synthesize other compounds.
