A8422732
N-Boc-N'-acetyl-L-lysine , ≧95% , 6404-26-8
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB159.20 | In Stock |
|
| 250mg | RMB159.20 | In Stock |
|
| 1g | RMB479.20 | In Stock |
|
| 5g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-138 °C |
| Boiling point: | 528.8±45.0 °C(Predicted) |
| Density | 1.124±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.99±0.21(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChI | 1S/C13H24N2O5/c1-9(16)14-8-6-5-7-10(11(17)18)15-12(19)20-13(2,3)4/h10H,5-8H2,1-4H3,(H,14,16)(H,15,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | IOKOUUAPSRCSNT-JTQLQIEISA-N |
| SMILES | N([C@@H](CCCCNC(=O)C)C(=O)O)C(=O)OC(C)(C)C |
| CAS DataBase Reference | 6404-26-8(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| WGK Germany | WGK 3 |
| HS Code | 2924190090 |
| Storage Class | 11 - Combustible Solids |
