A8425212
1-<WBR>Ethyl-<WBR>3-<WBR>methylimidazolium diethyl phosphate , 98% , 848641-69-0
Synonym(s):
1-Ethyl-3-methylimidazolium diethylphosphate;EMIM DEP
CAS NO.:848641-69-0
Empirical Formula: C10H21N2O4P
Molecular Weight:
MDL number: MFCD09953486
EINECS: 200-100-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5g | RMB52.80 | In Stock |
|
| 25G | RMB236.00 | In Stock |
|
| 100G | RMB737.60 | In Stock |
|
| 500g | RMB2375.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 19-21°C |
| Boiling point: | 196℃ at 101.325kPa |
| Density | 1.157 |
| vapor pressure | 1.2-10.9hPa at 25-60℃ |
| refractive index | n20/D 1.475 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Colorless to Yellow to Orange |
| PH | 5-7 (200g/l, H2O, 20℃) |
| Water Solubility | Fully miscible in water. |
| Sensitive | Moisture Sensitive |
| BRN | 10726450 |
| InChI | 1S/C6H11N2.C4H11O4P/c1-3-8-5-4-7(2)6-8;1-3-7-9(5,6)8-4-2/h4-6H,3H2,1-2H3;3-4H2,1-2H3,(H,5,6)/q+1;/p-1 |
| InChIKey | HQWOEDCLDNFWEV-UHFFFAOYSA-M |
| SMILES | CCn1cc[n+](C)c1.CCOP([O-])(=O)OCC |
| LogP | -0.22 at 25℃ and pH7.5 |
| CAS DataBase Reference | 848641-69-0 |
| ECW | 5.8 V |
Description and Uses
It finds its application in improving enzymatic hydrolysis of wheat straw and in the enzymatic in situ saccharification of cellulose in aqueous-ionic liquid media.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P270-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29332900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |







