A8432532
2-Chloro-6-fluorobenzylamine , ≥98%(GC) , 15205-15-9
CAS NO.：15205-15-9
Empirical Formula: C7H7ClFN
Molecular Weight: 159.59
MDL number: MFCD00042458
EINECS: 239-259-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB135.20 | In Stock |
|
| 25G | RMB455.20 | In Stock |
|
| 100G | RMB1577.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 91-93 °C/20 mmHg (lit.) |
| Density | 1.24 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 82 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| pka | 8.09±0.10(Predicted) |
| color | Clear colorless to light yellow |
| Sensitive | Air Sensitive |
| BRN | 2357724 |
| InChI | InChI=1S/C7H7ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H,4,10H2 |
| InChIKey | GVULSXIBCHPJEH-UHFFFAOYSA-N |
| SMILES | C1(CN)=C(F)C=CC=C1Cl |
| CAS DataBase Reference | 15205-15-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H314 |
| Precautionary statements | P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2735 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
