A8433212
D-(+)-Xylose , 98% , 58-86-6
Synonym(s):
D- (+)-Xylose
CAS NO.:58-86-6
Empirical Formula: C5H10O5
Molecular Weight: 150.13
MDL number: MFCD00151475
EINECS: 200-400-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB24.00 | In Stock |
|
| 100G | RMB41.60 | In Stock |
|
| 500G | RMB144.00 | In Stock |
|
| 2.5KG | RMB596.00 | In Stock |
|
| 10kg | RMB2082.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-158 °C(lit.) |
| alpha | 20 º (c=10, H2O) |
| Boiling point: | 191.65°C (rough estimate) |
| bulk density | 450kg/m3 |
| Density | 1.525 |
| FEMA | 3606 | D-XYLOSE |
| refractive index | 20 ° (C=10, H2O) |
| Flash point: | > 100°(212°F) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| pka | pKa (18°): 12.14 |
| form | Fine Crystalline Powder |
| color | White |
| Specific Gravity | 1.535 |
| PH | 4.0-6.0 (25℃, 1M in H2O) |
| PH Range | 4.5 - 6.0 |
| Odor | Odorless |
| Odor Type | smoky |
| optical activity | [α]20/D +20.0±1°, 10 hr, c = 10% in H2O |
| biological source | cell culture |
| Water Solubility | soluble |
| λmax | λ: 260 nm Amax: 0.05 λ: 280 nm Amax: 0.05 |
| Sensitive | Hygroscopic |
| Merck | 14,10087 |
| BRN | 1562108 |
| Henry's Law Constant | 8.2×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING HUMECTANT FRAGRANCE |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-IOVATXLUSA-N |
| SMILES | O[C@@H]1COC(O)[C@H](O)[C@H]1O |
| LogP | -1.98 |
| CAS DataBase Reference | 58-86-6(CAS DataBase Reference) |
| NIST Chemistry Reference | D-Xylose(58-86-6) |
| EPA Substance Registry System | D-Xylose (58-86-6) |
Description and Uses
D-Xylose is used in diagnostic malabsorption tests as well as in the production of Furfural.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 2 |
| RTECS | ZF2285000 |
| F | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazardous Substances Data | 58-86-6(Hazardous Substances Data) |
| REACH Registrations | Active |




