A8434532
2-Chloro-3-methoxypyridine , 97% , 52605-96-6
CAS NO.：52605-96-6
Empirical Formula: C6H6ClNO
Molecular Weight: 143.57
MDL number: MFCD03426022
EINECS: 258-039-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB158.40 | In Stock |
|
| 25g | RMB630.40 | In Stock |
|
| 100g | RMB2071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92°C |
| Boiling point: | 210.6±20.0 °C(Predicted) |
| Density | 1.210±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystalline solid |
| pka | -0.51±0.10(Predicted) |
| color | Light orange |
| Water Solubility | Insoluble in water. |
| BRN | 115568 |
| InChI | InChI=1S/C6H6ClNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| InChIKey | CCVNZKGBNUPYPG-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1OC |
| CAS DataBase Reference | 52605-96-6(CAS DataBase Reference) |
Description and Uses
It is a pharmaceutical raw material and also used in medicine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-37 |
| HS Code | 29333990 |
