A8435312
5-Bromo-4-chloro-3-indolyl β-D-galactopyranoside , 98% , 7240-90-6
Synonym(s):
X-Gal;BCIG;bromo-4-chloro-3-indolyl-β-d-galactopyranoside, 5-;5-Bromo-4-chloro-3-indolyl β-D -galactopyranoside;5-Bromo-4-chloro-3-indolyl β-D -galactoside
CAS NO.:7240-90-6
Empirical Formula: C14H15BrClNO6
Molecular Weight: 408.63
MDL number: MFCD00005666
EINECS: 230-640-8
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB40.80 | In Stock |
|
| 250MG | RMB64.80 | In Stock |
|
| 1G | RMB203.20 | In Stock |
|
| 5G | RMB836.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230 °C |
| alpha | -64 º (C=1, H2O/DMF (1/1)) |
| Boiling point: | 673.9±55.0 °C(Predicted) |
| Density | 1.5563 (rough estimate) |
| refractive index | 1.6110 (estimate) |
| storage temp. | -20°C |
| solubility | Soluble in 100 mM in DMSO. |
| pka | 12.74±0.70(Predicted) |
| form | Powder |
| color | White |
| Odor | Odorless |
| Sensitive | Moisture & Light Sensitive |
| Merck | 14,10074 |
| BRN | 1402009 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8-,11+,12+,13-,14-/m1/s1 |
| InChIKey | OPIFSICVWOWJMJ-AEOCFKNESA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@H](O)[C@@H](O)[C@H]1O |
| CAS DataBase Reference | 7240-90-6(CAS DataBase Reference) |
Description and Uses
magenta b-galactosidase substrate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264b-P270-P271-P280-P302+P352-P304+P340-P312-P330-P363-P403-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39-26 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HazardClass | IRRITANT |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |




![5-Bromo-4-chloro-3-indolyl β-<small>D</small>-Glucuronide Sodium Salt [for Biochemical Research]](https://img.chemicalbook.com/CAS/GIF/129541-41-9.gif)


