A8436112
Xanthene , 98% , 92-83-1
CAS NO.:92-83-1
Empirical Formula: C13H10O
Molecular Weight: 182.22
MDL number: MFCD00005055
EINECS: 202-194-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5G | RMB120.80 | In Stock |
|
| 25G | RMB396.00 | In Stock |
|
| 100G | RMB1212.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-102 °C(lit.) |
| Boiling point: | 310-312 °C(lit.) |
| Density | 1.0368 (rough estimate) |
| refractive index | 1.5994 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 30 |
| color | White to Light yellow to Dark green |
| Water Solubility | soluble |
| BRN | 133939 |
| Stability: | Stable. Combustible. Incompatible with oxidizing agents. |
| InChI | InChI=1S/C13H10O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8H,9H2 |
| InChIKey | GJCOSYZMQJWQCA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)OC2=C1C=CC=C2 |
| LogP | 4.230 |
| CAS DataBase Reference | 92-83-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Xanthene(92-83-1) |
| EPA Substance Registry System | 9H-Xanthene (92-83-1) |
Description and Uses
Xanthene is useful for the preparation of CoIV-Dinitrate Complex.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 42/43 |
| Safety Statements | 22-36/37-45-24-36/37/39 |
| WGK Germany | 3 |
| RTECS | ZD5520000 |
| TSCA | TSCA listed |
| HS Code | 29181100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |





