A8437132
5-<WBR>(4-<WBR>Chlorophenyl)<WBR>furfural , 95% , 34035-03-5
Synonym(s):
5-(4-Chlorophenyl)-2-furancarboxaldehyde
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB121.60 | In Stock |
|
| 25G | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-131 °C (lit.) |
| Boiling point: | 350.7±32.0 °C(Predicted) |
| Density | 1.282±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Needles |
| color | Pale brown |
| InChI | 1S/C11H7ClO2/c12-9-3-1-8(2-4-9)11-6-5-10(7-13)14-11/h1-7H |
| InChIKey | ROJGJNINTRCMBL-UHFFFAOYSA-N |
| SMILES | Clc1ccc(cc1)-c2ccc(C=O)o2 |
| CAS DataBase Reference | 34035-03-5(CAS DataBase Reference) |
Description and Uses
5-(4-Chlorophenyl)furfural was used as one of the aldehydes in the synthesis of uridine-based library.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







