A8437612
Xanthene-9-carboxylic acid , 98% , 82-07-5
Synonym(s):
Xanthene-9-carboxylic acid
CAS NO.：82-07-5
Empirical Formula: C14H10O3
Molecular Weight: 226.23
MDL number: MFCD00005059
EINECS: 201-394-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB263.20 | In Stock |
|
| 100G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-225 °C (lit.) |
| Boiling point: | 391.3±41.0 °C(Predicted) |
| Density | 1.335±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| pka | 4.30±0.20(Predicted) |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 174414 |
| InChI | InChI=1S/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16) |
| InChIKey | VSBFNCXKYIEYIS-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)C2=C(C=CC=C2)OC2=C1C=CC=C2 |
| CAS DataBase Reference | 82-07-5(CAS DataBase Reference) |
Description and Uses
Xanthene-9-carboxylic Acid is xanthrene derivative that is capable of inhibiting the TTR conformational changes facilitating amyloid fibril formation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39-37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HS Code | 29329990 |
