A8440012
Xanthosine , ≥98.0%(HPLC) , 146-80-5
CAS NO.:146-80-5
Empirical Formula: C10H12N4O6
Molecular Weight: 284.23
MDL number: MFCD00005726
EINECS: 205-679-9
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB91.20 | In Stock |
|
| 500MG | RMB349.60 | In Stock |
|
| 2g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174~176℃ |
| Density | 2.25±0.1 g/cm3(Predicted) |
| refractive index | -52 ° (C=8, 0.3mol/L NaOH) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Aqueous Base (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | pK1:<2.5(+1);pK2:5.67(0);pK3:12.00(-1) (25°C) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,10065 |
| Stability: | Hygroscopic |
| InChI | 1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | UBORTCNDUKBEOP-UUOKFMHZSA-N |
| SMILES | O[C@H]1[C@@H](O)[C@H](N(C=N2)C3=C2C(NC(N3)=O)=O)O[C@@H]1CO |
| CAS DataBase Reference | 146-80-5(CAS DataBase Reference) |
Description and Uses
Xanthosine-13C5, is the labeled analogue of Xanthosine (X742100), the deamination product of Guanosine. It is also a potential biomarker for detecting radiation exposure.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H332-H314 |
| Precautionary statements | P501-P260-P270-P271-P264-P280-P303+P361+P353-P301+P330+P331-P363-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P405 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |







