A8453712
N-Z-Ethylenediamine hydrochloride , 98% , 18807-71-1
Synonym(s):
N-Z-1,2-Diaminoethane hydrochloride;Benzyl N-(2-aminoethyl)carbamate hydrochloride
CAS NO.：18807-71-1
Empirical Formula: C10H15ClN2O2
Molecular Weight: 230.69
MDL number: MFCD00270150
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB48.80 | In Stock |
|
| 1g | RMB51.20 | In Stock |
|
| 5g | RMB335.20 | In Stock |
|
| 25g | RMB1056.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-172 °C(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solution Product May Develop Some Turbidity or Precipitate |
| color | Slightly yellow to brown |
| BRN | 4724532 |
| InChI | 1S/C10H14N2O2.ClH/c11-6-7-12-10(13)14-8-9-4-2-1-3-5-9;/h1-5H,6-8,11H2,(H,12,13);1H |
| InChIKey | QMLKQXIAPAAIEJ-UHFFFAOYSA-N |
| SMILES | [H]Cl.NCCNC(OCC1=CC=CC=C1)=O |
Description and Uses
N-(Benzyloxycarbonyl)ethylenediamine Hydrochloride is a reagent used to synthesize new opioid ligand as an analgesics with mixed agonist and antagonist properties to induce tolerance and dependence.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
