S8950114
136132-67-7
Synonym(s):
APP secretase;CPSB;Z-RR-AMC
CAS NO.:136132-67-7
Empirical Formula: C30H40ClN9O6
Molecular Weight: 658.15
MDL number: MFCD00133576
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB823.54 | In Stock |
|
| 25mg | RMB2662.27 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | DMSO: 5mg/mL water: soluble |
| form | aqueous solution |
| color | White to off-white |
| biological source | human |
| Water Solubility | water: soluble |
| Specific Activity | ≥2228pmol/min-μg |
| Sequence | Z-Arg-Arg-AMC |
| InChIKey | HLSNWWKWVKPXKI-UHFFFAOYSA-N |
| SMILES | Cl.CC1=CC(=O)Oc2cc(NC(=O)C(CCCNC(N)=N)NC(=O)C(CCCNC(N)=N)NC(=O)OCc3ccccc3)ccc12 |
Description and Uses
Z-Arg-Arg-7-amido-4-methylcoumarin hydrochloride has been used:
- as a cathepsin B substrate in zymography analysis of protease in feces extract.
- in cathepsin B activity assay.
- as a fluorogenic peptide substrate to determine the matrix metalloproteinase enzyme activity.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H319-H360D |
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |








