BD4963741
Benzyl(4-aminobutyl)carbamatehydrochloride , 97% , 18807-73-3
Synonym(s):
Benzyl N-(4-aminobutyl)carbamate hydrochloride
CAS NO.:18807-73-3
Empirical Formula: C12H19ClN2O2
Molecular Weight: 258.74
MDL number: MFCD00270149
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB140.80 | In Stock |
|
| 1g | RMB244.00 | In Stock |
|
| 5g | RMB1203.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-196 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 4725911 |
| InChI | InChI=1S/C12H18N2O2.ClH/c13-8-4-5-9-14-12(15)16-10-11-6-2-1-3-7-11;/h1-3,6-7H,4-5,8-10,13H2,(H,14,15);1H |
| InChIKey | ZVNNCIIFBSRHFE-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1)COC(=O)NCCCCN.Cl |
| CAS DataBase Reference | 18807-73-3(CAS DataBase Reference) |
Description and Uses
N-Carbobenzoxy-1,4-diaminobutane HCl is used in the synthetic preparation of pyrazolyl glucopyranoside and galactopyranoside derivative inhibitors of human sodium-glucose cotransporter 1 (SGLT1) for preventives or therapeutics for diseases related to hyperglycemia or galactosemia.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 2922.39.4500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






