A8454532
2,6-Dichloro-3-(trifluoromethyl)pyridine , 98% , 55304-75-1
CAS NO.：55304-75-1
Empirical Formula: C6H2Cl2F3N
Molecular Weight: 215.99
MDL number: MFCD00042245
EINECS: 259-585-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB42.40 | In Stock |
|
| 1g | RMB71.20 | In Stock |
|
| 5G | RMB204.80 | In Stock |
|
| 25g | RMB791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194 °C |
| Boiling point: | 194-196 °C(lit.) |
| Density | 2.008 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 218 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -4.84±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| BRN | 1570287 |
| InChI | InChI=1S/C6H2Cl2F3N/c7-4-2-1-3(5(8)12-4)6(9,10)11/h1-2H |
| InChIKey | UPWAAFFFSGQECJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1C(F)(F)F |
| CAS DataBase Reference | 55304-75-1(CAS DataBase Reference) |
Description and Uses
2,6-Dichloro-3-(trifluoromethyl)pyridine is a fluorine-containing pyridine derivative that can be used in cross-coupling reactions of polyhalogenated heterocycles and in the preparation of other aryl pyridines.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H312-H331-H300-H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P405-P501a-P261-P264-P301+P310-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36/37-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
