A8455212
Zirconium(IV) acetylacetonate , 98% , 17501-44-9
Synonym(s):
2,4-Pentanedione zirconium(IV) derivative;Tetrakis(2,4-pentanedionato)zirconium(IV);Tetrakis(2,4-pentanedionato)zirconium(IV), Tetrakis(acetylacetonato)zirconium(IV);Zirconium(IV) 2,4-pentanedionate;Zirconium(IV) acetylacetonate
CAS NO.:17501-44-9
Empirical Formula: C20H28O8Zr
Molecular Weight: 487.66
MDL number: MFCD00000036
EINECS: 241-510-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 25G | RMB80.00 | In Stock |
|
| 100G | RMB222.40 | In Stock |
|
| 500G | RMB887.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-195 °C |
| Density | 1.42g/cm3 at 20℃ |
| bulk density | 500kg/m3 |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Store below +30°C. |
| solubility | 14g/l |
| form | Powder |
| color | white |
| PH | 7.2 (4.5g/l, H2O, 20℃) |
| Water Solubility | Soluble in water. |
| BRN | 4160373 |
| Exposure limits | ACGIH: TWA 5 mg/m3; STEL 10 mg/m3 NIOSH: IDLH 25 mg/m3; TWA 5 mg/m3; STEL 10 mg/m3 |
| InChI | 1S/4C5H8O2.Zr/c4*1-4(6)3-5(2)7;/h4*3,6H,1-2H3;/q;;;;+4/p-4/b4*4-3-; |
| InChIKey | FPFOSIXCIBGKOH-MTOQALJVSA-J |
| SMILES | CC(=O)\C=C(\C)O[Zr](O\C(C)=C/C(C)=O)(O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| LogP | 0.12-0.2 at 20℃ and pH7.1 |
| Surface tension | 67.28mN/m at 1g/L and 20℃ |
| EPA Substance Registry System | Zirconium, tetrakis(2,4-pentanedionato-.kappa.O,.kappa.O')-, (SA-8-11''11''1'1'''1'1''')- (17501-44-9) |
Description and Uses
Starting material for zirconium metallomesogens: zirconium tetrakis-β-diketonate liquid crystals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-40-36/37/38-20/21/22-63 |
| Safety Statements | 22-24/25-36/37-26-7 |
| WGK Germany | 3 |
| RTECS | ZH9280000 |
| TSCA | TSCA listed |
| HS Code | 2914 19 90 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Flam. Sol. 1 |
| Toxicity | LD50 orally in Rabbit: 719 mg/kg |





