A8455912
Z-L-Alanine , 98% , 1142-20-7
Synonym(s):
Carbobenzyloxy-L -alanine;Z-Ala-OH
CAS NO.:1142-20-7
Empirical Formula: C11H13NO4
Molecular Weight: 223.23
MDL number: MFCD00002640
EINECS: 214-532-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB135.20 | In Stock |
|
| 500g | RMB615.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-87 °C |
| alpha | -15 º (c=2, AcOH 24 ºC) |
| Boiling point: | 364.51°C (rough estimate) |
| Density | 1.2446 (rough estimate) |
| refractive index | -14.5 ° (C=2, AcOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.00±0.10(Predicted) |
| form | Powder |
| color | White |
| optical activity | [α]23/D 14.2°, c = 2 in acetic acid |
| BRN | 2056164 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C11H13NO4/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14)/t8-/m0/s1 |
| InChIKey | TYRGLVWXHJRKMT-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](C)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 1142-20-7(CAS DataBase Reference) |
Description and Uses
N-Benzyloxycarbonyl-L-alanine is an intermediate in the synthesis of Perindopril (P287500), an angiotensin-converting enzyme (ACE) inhibitor. Antihypertensive.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







