A8477012
Z-Ala-Ala-OH , 98% , 16012-70-7
CAS NO.:16012-70-7
Empirical Formula: C14H18N2O5
Molecular Weight: 294.3
MDL number: MFCD00037234
EINECS: 240-149-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB82.40 | In Stock |
|
| 5G | RMB288.00 | In Stock |
|
| 25G | RMB781.60 | In Stock |
|
| 100G | RMB2332.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-140 °C |
| Boiling point: | 573.0±45.0 °C(Predicted) |
| Density | 1.252±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.51±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| optical activity | -23.3° (C=1.00 g/100ml ETHANOL) |
| InChI | 1S/C14H18N2O5/c1-9(12(17)15-10(2)13(18)19)16-14(20)21-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,15,17)(H,16,20)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | JBGCVTHXXTVYIP-UWVGGRQHSA-N |
| SMILES | O=C(N[C@@H](C)C(N[C@@H](C)C(O)=O)=O)OCC1=CC=CC=C1 |
Description and Uses
Z-Ala-Ala-OH is a non-polar amino acid that can be used in enzymatic peptide synthesis[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |







