PRODUCT Properties
| Melting point: | 86-88°C |
| Boiling point: | 315°C |
| Density | 1,687 g/cm3 |
| refractive index | 1.5870 (estimate) |
| Flash point: | 315°C |
| storage temp. | 2-8°C |
| form | solid |
| color | Pale-yellow to Yellow-brown |
| Water Solubility | Soluble in alcohol. Moderately soluble in benzene, ether. Practically insoluble in water. |
| Merck | 14,2137 |
| BRN | 522187 |
| InChI | InChI=1S/C6H3ClN2O4/c7-6-4(8(10)11)2-1-3-5(6)9(12)13/h1-3H |
| InChIKey | BPPMIQPXQVIZNJ-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=CC([N+]([O-])=O)=C1Cl |
| CAS DataBase Reference | 606-21-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Chloro-2,6-dinitrobenzene(606-21-3) |
| EPA Substance Registry System | 2,6-Dinitrochlorobenzene (606-21-3) |
Description and Uses
The commercial mixture of chlorodinitrobenzenes is used to synthesize other compounds.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H310-H330-H373-H400-H410 |
| Precautionary statements | P301+P310a-P304+P340-P320-P330-P405-P501a |
| Risk Statements | 23/24/25-33-50/53 |
| Safety Statements | 28-36/37-45-60-61 |
| RIDADR | 3441 |
| RTECS | CZ0525500 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049090 |
| Hazardous Substances Data | 606-21-3(Hazardous Substances Data) |






