A8462612
Z-Asp-OMe , 98% , 4668-42-2
Synonym(s):
N-Cbz-L -aspartic acid α-methyl ester;Z-L -Aspartic acid 1-methyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB76.80 | In Stock |
|
| 10g | RMB172.00 | In Stock |
|
| 25G | RMB320.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89.0 to 93.0 °C |
| Boiling point: | 498.9±45.0 °C(Predicted) |
| Density | 1.304±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.09±0.19(Predicted) |
| color | White to Almost white |
| BRN | 4813538 |
| Major Application | peptide synthesis |
| InChI | 1S/C13H15NO6/c1-19-12(17)10(7-11(15)16)14-13(18)20-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,14,18)(H,15,16)/t10-/m0/s1 |
| InChIKey | MFFFBNAPQRDRQW-JTQLQIEISA-N |
| SMILES | COC(=O)[C@H](CC(O)=O)NC(=O)OCc1ccccc1 |
| CAS DataBase Reference | 4668-42-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H332-H318 |
| Precautionary statements | P261-P264-P280-P301+P312-P304+P340+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/22-37-41 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 |








