A8467012
1-Z-4-Piperidone , 98% , 19099-93-5
Synonym(s):
1-(Benzyloxycarbonyl)-4-piperidinone;1-Cbz-4-Piperidone;Benzyl 4-oxo-1-piperidinecarboxylate
CAS NO.:19099-93-5
Empirical Formula: C13H15NO3
Molecular Weight: 233.26
MDL number: MFCD00673144
EINECS: 606-227-7
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-41°C |
| Boiling point: | 114-140 °C/0.25 mmHg (lit.) |
| Density | 1.172 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >110 °C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform, Dichloromethane, Ethyl Acetate, Methanol |
| form | Solid or Lliquid |
| pka | -1.63±0.20(Predicted) |
| Specific Gravity | 1.185 |
| color | White to pale yellow |
| BRN | 1533716 |
| InChI | InChI=1S/C13H15NO3/c15-12-6-8-14(9-7-12)13(16)17-10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | VZOVOHRDLOYBJX-UHFFFAOYSA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CCC(=O)CC1 |
| CAS DataBase Reference | 19099-93-5(CAS DataBase Reference) |
Description and Uses
Protected piperidinone that can undergo interesting synthetic transformations including the Knoevenagel reaction,1 hetero-Diels-Alder reactions,2 and reactions to form N-(4-piperidinyl)oxindoles.3
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H412 |
| Precautionary statements | P264-P270-P273-P301+P312-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-36-26-37/39 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |







