A8472812
Zinc(II) Dibutyldithiocarbamate , >98.0%(T) , 136-23-2
CAS NO.:136-23-2
Empirical Formula: C18H36N2S4Zn
Molecular Weight: 474.14
MDL number: MFCD00067274
EINECS: 205-232-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB45.60 | In Stock |
|
| 500G | RMB113.60 | In Stock |
|
| 25kg | RMB503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-110°C |
| Boiling point: | 318℃[at 101 325 Pa] |
| Density | 1,21 g/cm3 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Insoluble in water |
| form | solid |
| Specific Gravity | 1.21 |
| color | White |
| Odor | wh. powd., pleasant odor |
| Water Solubility | 100μg/L at 25℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Cosmetics Ingredients Functions | ANTIOXIDANT ANTIMICROBIAL |
| InChI | 1S/2C9H19NS2.Zn/c2*1-3-5-7-10(9(11)12)8-6-4-2;/h2*3-8H2,1-2H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | BOXSVZNGTQTENJ-UHFFFAOYSA-L |
| SMILES | CCCCN(CCCC)C(=S)S[Zn]SC(=S)N(CCCC)CCCC |
| LogP | 2.16 at 25℃ |
| CAS DataBase Reference | 136-23-2(CAS DataBase Reference) |
| EPA Substance Registry System | Zinc dibutyldithiocarbamate (136-23-2) |
Description and Uses
Zinc dibutyldithiocarbamate is used as activator; antidegradant; accelerator for natural rubber, butadiene, styrene-butadiene, nitrile-butadiene, butyl rubber, and ethyJene-propylene-diene terpolymers.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335-H410 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53-43 |
| Safety Statements | 26-36/37/39-61-60-37-24 |
| RIDADR | 3077 |
| WGK Germany | WGK 2 |
| RTECS | ZH0175000 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9051 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Hazardous Substances Data | 136-23-2(Hazardous Substances Data) |
| Toxicity | LD50 ipr-mus: 100 mg/kg NTIS** AD277-689 |








