A8454212
Zinc diethyldithiocarbamate , 98% , 14324-55-1
CAS NO.:14324-55-1
Empirical Formula: C10H20N2S4Zn
Molecular Weight: 361.93
MDL number: MFCD00064798
EINECS: 238-270-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB34.40 | In Stock |
|
| 500G | RMB135.20 | In Stock |
|
| 2.5kg | RMB540.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-181 °C (lit.) |
| Boiling point: | 330.6°C (estimate) |
| Density | 1,48 g/cm3 |
| vapor pressure | 0.007Pa at 25℃ |
| Flash point: | 204°(400°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Sparingly), Methanol (Slightly, Heated, Sonicated) |
| form | solid |
| Specific Gravity | 1.48 |
| color | White |
| Water Solubility | Insoluble in water. Soluble in benzene carbon disulfide and organic liquids. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/2C5H11NS2.Zn/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | RKQOSDAEEGPRER-UHFFFAOYSA-L |
| SMILES | CCN(CC)C(=S)S[Zn]SC(=S)N(CC)CC |
| LogP | 3.11 |
| CAS DataBase Reference | 14324-55-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(diethyldithiocarbamate)zinc complex(14324-55-1) |
| EPA Substance Registry System | Ethyl ziram (14324-55-1) |
Description and Uses
Zinc diethyldithiocarbamate is a chelating ligand. It is used as a common accelerator to latex. A fast curing primary or secondary effective ultra-accelerator for natural and synthetic latex compounds.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H373-H410 |
| Precautionary statements | P273-P280-P301+P312-P302+P352-P305+P351+P338-P314 |
| target organs | Liver,spleen, Respiratory system |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/37/38-43-50/53 |
| Safety Statements | 24-37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | ZH0350000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29302000 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT RE 2 Oral STOT SE 3 |
| Hazardous Substances Data | 14324-55-1(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 3340 mg/kg 28ZPAK -,11,72 |







