PRODUCT Properties
| Flash point: | 36 °C |
| storage temp. | Refrigerator |
| form | preswollen, microgranular |
| color | Off-White to Light Grey |
| PH | 2—12 |
| Cosmetics Ingredients Functions | ABSORBENT |
| InChI | 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3?,4?,5?,6?,7?,8?,9?,10-,11?,12+/m1/s1 |
| InChIKey | GUBGYTABKSRVRQ-WFVLMXAXSA-N |
| SMILES | OC[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@H](O)[C@@H](O)O[C@H]2CO)[C@@H](O)[C@H](O)[C@H]1O |
| EPA Substance Registry System | Cellulose, 2-(diethylamino)ethyl ether (9013-34-7) |
Description and Uses
A cellulose Ion-exchange adsorbent
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 10-36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 1170 3/PG 3 |
| WGK Germany | 3 |
| F | 3 |
| TSCA | TSCA listed |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
