A8480232
6-Ethyl-3-formylchromone , 95% , 42059-78-9
Synonym(s):
6-Ethyl-4-oxo-4H-1-benzopyran-3-carboxaldehyde
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB183.20 | In Stock |
|
| 1G | RMB380.80 | In Stock |
|
| 5g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-110 °C (lit.) |
| Boiling point: | 343.3±42.0 °C(Predicted) |
| Density | 1.308±0.06 g/cm3(Predicted) |
| InChI | 1S/C12H10O3/c1-2-8-3-4-11-10(5-8)12(14)9(6-13)7-15-11/h3-7H,2H2,1H3 |
| InChIKey | XCKTXKYXKJJGBA-UHFFFAOYSA-N |
| SMILES | CCc1ccc2OC=C(C=O)C(=O)c2c1 |
| CAS DataBase Reference | 42059-78-9(CAS DataBase Reference) |
Description and Uses
6-Ethyl-3-formylchromone is the suitable reagent used in the synthesis of uridine-based library. It may be used in the synthesis of ethyl 3-acetyl-5-(5-ethyl-2-hydroxybenzoyl)-2-hydroxybenzoate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
