A8483732
3-Fluoro-4-hydroxy-5-methoxybenzaldehyde , 97% , 79418-78-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB201.60 | In Stock |
|
| 1g | RMB526.40 | In Stock |
|
| 5G | RMB1574.40 | In Stock |
|
| 25g | RMB6212.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-118 °C (lit.) |
| Boiling point: | 114-118℃ |
| Density | 1.331±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 6.54±0.23(Predicted) |
| form | Powder |
| color | Yelloe to pale brown |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C8H7FO3/c1-12-7-3-5(4-10)2-6(9)8(7)11/h2-4,11H,1H3 |
| InChIKey | OOGOFUKAJDPHDJ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(OC)=C(O)C(F)=C1 |
| CAS DataBase Reference | 79418-78-3(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-hydroxy-5-methoxybenzaldehyde may be used to synthesize 3-(3-fluoro-4-hydroxy-5-methoxyphenyl)-N-phenethylacrylamide and 4-[(4-hydroxy-3-fluoro-5-methoxy-benzylidene)amino]-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2913000090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




