A8502832
Isopropenylboronic acid pinacol ester , ≥98%, containing 5000 ppm pheaside stabilizer , 126726-62-3
Synonym(s):
2-Isopropenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4,4,5,5-tetramethyl-2-(1-methylethenyl)-1,3,2-dioxaborolane;4,4,5,5-Tetramethyl-2-(isopropenyl)-1,3,2-dioxaborolane;4,4,5,5-Tetramethyl-2-(prop-1-en-2-yl)-1,3,2-dioxaborolane
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 5g | RMB47.20 | In Stock |
|
| 25g | RMB155.20 | In Stock |
|
| 100g | RMB547.20 | In Stock |
|
| 500g | RMB1863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-161 °C |
| Boiling point: | 47-49 °C/9 mbar |
| Density | 0.894 g/mL at 25 °C |
| refractive index | 1.4320 |
| Flash point: | 42 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Clear, colorless to brown |
| InChI | InChI=1S/C9H17BO2/c1-7(2)10-11-8(3,4)9(5,6)12-10/h1H2,2-6H3 |
| InChIKey | SVSUYEJKNSMKKW-UHFFFAOYSA-N |
| SMILES | O1C(C)(C)C(C)(C)OB1C(C)=C |
| CAS DataBase Reference | 126726-62-3 |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H317-H319-H335-H412 |
| Precautionary statements | P210-P233-P273-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38-43 |
| Safety Statements | 16-26-36/37 |
| RIDADR | UN 1993 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29349990 |
